CAS 55682-47-8 is the registry number for 1,6-Anhydro-2-azido-4-O-benzyl-2-deoxy-b-D-glucopyranose. Offered by: Chemat, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg, 2000mg, 5000mg.
(1R,2S,3R,4R,5R)-4-azido-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol (CAS 55682-47-8) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: (1R,2S,3R,4R,5R)-4-azido-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol. InChIKey: CSEKEFNIXUCHND-SYLRKERUSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | (1R,2S,3R,4R,5R)-4-azido-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| InChIKey | CSEKEFNIXUCHND-SYLRKERUSA-N |
| SMILES | C1[C@@H]2[C@H]([C@@H]([C@H]([C@H](O1)O2)N=[N+]=[N-])O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)