Products 56472-71-0
CAS 56472-71-0 is the registry number for Bupropion impurity 14. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E)-1-(3-chlorophenyl)-2-hydroxyiminopropan-1-one (CAS 56472-71-0) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: (2E)-1-(3-chlorophenyl)-2-hydroxyiminopropan-1-one. InChIKey: JPDFPMKNWYXTDS-IZZDOVSWSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | (2E)-1-(3-chlorophenyl)-2-hydroxyiminopropan-1-one |
| InChIKey | JPDFPMKNWYXTDS-IZZDOVSWSA-N |
| SMILES | C/C(=N\O)/C(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)