CAS 5791-00-4 appears in our catalog under these names: 6–Chloro–2–methyl–2H–1,4–benzoxazin–3(4H)–one, 6-Chloro-2-methyl-2H-1,4-benzoxazin-3(4H)-one, 6-Chloro-2-methyl-2H-1,4-benzoxazin-3(4H)-one, >98.0%(GC), 6-CHLORO-2-METHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 97%. Offered by: GLPBio, Biosynth, TCI, Fluorochem. Available pack sizes: 1g, 200mg, 10g, 5g.
6-chloro-2-methyl-4H-1,4-benzoxazin-3-one (CAS 5791-00-4) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 6-chloro-2-methyl-4H-1,4-benzoxazin-3-one. InChIKey: MGOCBXKZDZRPMK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 6-chloro-2-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | MGOCBXKZDZRPMK-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)