Products 61023-75-4
CAS 61023-75-4 is the registry number for Cyclopentanecarbonitrile, 1-(2,4-dichlorophenyl)-, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,4-dichlorophenyl)cyclopentane-1-carbonitrile (CAS 61023-75-4) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)cyclopentane-1-carbonitrile. InChIKey: RVLMAXHTTGFOID-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)cyclopentane-1-carbonitrile |
| InChIKey | RVLMAXHTTGFOID-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C#N)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)