CAS 623148-01-6 is the registry number for 4-Bromo-2,6-difluorophenyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-bromo-2,6-difluorophenyl) acetate (CAS 623148-01-6) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: (4-bromo-2,6-difluorophenyl) acetate. InChIKey: RRTOWBGIFRFPFK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | (4-bromo-2,6-difluorophenyl) acetate |
| InChIKey | RRTOWBGIFRFPFK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1F)Br)F |
Computed by PubChem (NCBI)