Products 63059-56-3
CAS 63059-56-3 appears in our catalog under these names: 4，5–dichloro–N–ethyl–2–nitroaniline, 4,5-dichloro-N-ethyl-2-nitroaniline, >98%, >98%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 50mg, 250mg.
4,5-dichloro-N-ethyl-2-nitroaniline (CAS 63059-56-3) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 4,5-dichloro-N-ethyl-2-nitroaniline. InChIKey: IYHKPJYDDKJPLJ-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 4,5-dichloro-N-ethyl-2-nitroaniline |
| InChIKey | IYHKPJYDDKJPLJ-UHFFFAOYSA-N |
| SMILES | CCNC1=CC(=C(C=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)