Products 68119-30-2
CAS 68119-30-2 appears in our catalog under these names: 5-(Bromomethyl)-2,2-difluorobenzo[d][1,3]dioxole, 95%, 5-(Bromomethyl)-2,2-difluorobenzo(d)(1,3)dioxole, 95+%, 5-(Bromomethyl)-2,2-difluoro-2H-1,3-benzodioxole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 100mg.
5-(bromomethyl)-2,2-difluoro-1,3-benzodioxole (CAS 68119-30-2) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 5-(bromomethyl)-2,2-difluoro-1,3-benzodioxole. InChIKey: AJSFRSHQRVBBKB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 5-(bromomethyl)-2,2-difluoro-1,3-benzodioxole |
| InChIKey | AJSFRSHQRVBBKB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CBr)OC(O2)(F)F |
Computed by PubChem (NCBI)