CAS 70063-07-9 appears in our catalog under these names: Carbazochrome Impurity 33, Carbazochrome Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
[(6-hydroxy-1-methylindol-5-yl)amino]urea (CAS 70063-07-9) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: [(6-hydroxy-1-methylindol-5-yl)amino]urea. InChIKey: WBEHXMHDIODPJF-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | [(6-hydroxy-1-methylindol-5-yl)amino]urea |
| InChIKey | WBEHXMHDIODPJF-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=CC(=C(C=C21)O)NNC(=O)N |
Computed by PubChem (NCBI)