Products 701917-03-5
CAS 701917-03-5 appears in our catalog under these names: 4-Nitro-1-phenyl-1H-pyrazole-3-carboxylic acid, 4-Nitro-1-phenyl-1H-pyrazole-3-carboxylic acid, 98%, 4-Nitro-1-phenyl-1H-pyrazole-3-carboxylic acid, 97%. Offered by: Biosynth, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g.
4-nitro-1-phenylpyrazole-3-carboxylic acid (CAS 701917-03-5) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 4-nitro-1-phenylpyrazole-3-carboxylic acid. InChIKey: HZENRRKFQYHSJU-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O4 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 4-nitro-1-phenylpyrazole-3-carboxylic acid |
| InChIKey | HZENRRKFQYHSJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)