CAS 72769-08-5 appears in our catalog under these names: 5–Chloro–2,2–difluorobenzo(d)(1,3)dioxole, 5-Chloro-2,2-difluoro-1,3-benzodioxole, 98%, 5-Chloro-2,2-difluorobenzo[d][1,3]dioxole, 98%, 98%, 5-Chloro-2,2-difluoro-benzo[1,3]dioxole, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g, 10g.
5-chloro-2,2-difluoro-1,3-benzodioxole (CAS 72769-08-5) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 5-chloro-2,2-difluoro-1,3-benzodioxole. InChIKey: CVICEEPAFUYBJG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 5-chloro-2,2-difluoro-1,3-benzodioxole |
| InChIKey | CVICEEPAFUYBJG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC(O2)(F)F |
Computed by PubChem (NCBI)