CAS 75898-90-7 is the registry number for Amrinone (lactate). Offered by: MedChemExpress. Available pack sizes: Get quote.
3-amino-5-pyridin-4-yl-1H-pyridin-2-one;2-hydroxypropanoic acid (CAS 75898-90-7) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: 3-amino-5-pyridin-4-yl-1H-pyridin-2-one;2-hydroxypropanoic acid. InChIKey: DOSIONJFGDSKCQ-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 3-amino-5-pyridin-4-yl-1H-pyridin-2-one;2-hydroxypropanoic acid |
| InChIKey | DOSIONJFGDSKCQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)O.C1=CN=CC=C1C2=CNC(=O)C(=C2)N |
Computed by PubChem (NCBI)