CAS 765300-02-5 appears in our catalog under these names: 5-Bromo-2,2-difluoro-4-methylbenzo-1,3-dioxole, 5-Bromo-2,2-difluoro-4-methylbenzo(D)(1,3)dioxole, 5-Bromo-2,2-difluoro-4-methylbenzo[d][1,3]dioxole 95%, 5-Bromo-2,2-difluoro-4-methylbenzo[d][1,3]dioxole, 95%, 95%. Offered by: TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 2,5g, 0,5g, 50mg, 100mg, 250mg, 1g.
5-bromo-2,2-difluoro-4-methyl-1,3-benzodioxole (CAS 765300-02-5) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 5-bromo-2,2-difluoro-4-methyl-1,3-benzodioxole. InChIKey: ZQGDTIYYEFNNBV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 5-bromo-2,2-difluoro-4-methyl-1,3-benzodioxole |
| InChIKey | ZQGDTIYYEFNNBV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1OC(O2)(F)F)Br |
Computed by PubChem (NCBI)