CAS 773134-11-5 appears in our catalog under these names: Methyl 4-bromo-2,6-difluorobenzoate 98%, Methyl 4-Bromo-2,6-Difluorobenzoate, 98%, 98%, Methyl-4-bromo-2,6-difluorobenzoate, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g, 1kg.
Methyl 4-bromo-2,6-difluorobenzoate (CAS 773134-11-5) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 4-bromo-2,6-difluorobenzoate. InChIKey: JBXJLZRTTCGLNR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 4-bromo-2,6-difluorobenzoate |
| InChIKey | JBXJLZRTTCGLNR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1F)Br)F |
Computed by PubChem (NCBI)