CAS 842955-63-9 is the registry number for 3-(5,7-Dimethyl-(1,2,4)triazolo(1,5-a)pyrimidin-6-yl)-propionic acid. Offered by: Biosynth. Available pack sizes: 2,5g.
3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoic acid (CAS 842955-63-9) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoic acid. InChIKey: NWSSSDXVQWXROX-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoic acid |
| InChIKey | NWSSSDXVQWXROX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=NC=NN12)C)CCC(=O)O |
Computed by PubChem (NCBI)