Products 854267-90-6
CAS 854267-90-6 appears in our catalog under these names: 1-(6-CHLOROPYRIDIN-3-YL)CYCLOPROPANECARBOXYLIC ACID, 97%, 1-(6-Chloropyridin-3-yl)cyclopropanecarboxylic acid, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(6-chloro-3-pyridinyl)cyclopropane-1-carboxylic acid (CAS 854267-90-6) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 1-(6-chloro-3-pyridinyl)cyclopropane-1-carboxylic acid. InChIKey: ZJNKQXKFPFVZIU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 1-(6-chloro-3-pyridinyl)cyclopropane-1-carboxylic acid |
| InChIKey | ZJNKQXKFPFVZIU-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CN=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)