CAS 86093-06-3 is the registry number for 2-Chloro-5-hydroxybenzenesulfonamide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-5-hydroxybenzenesulfonamide (CAS 86093-06-3) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 2-chloro-5-hydroxybenzenesulfonamide. InChIKey: OCYUYTAYUAHUNW-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S |
|---|---|
| Molecular weight | 207.64 g/mol |
| IUPAC name | 2-chloro-5-hydroxybenzenesulfonamide |
| InChIKey | OCYUYTAYUAHUNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)