CAS 874498-79-0 appears in our catalog under these names: 4-Hydroxy-6,8-dimethoxyquinoline-3-carboxylic acid, 95%, 4-Hydroxy-6,8-dimethoxyquinoline-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
6,8-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid (CAS 874498-79-0) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 6,8-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: UAUGYIAYNNSEBS-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 6,8-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | UAUGYIAYNNSEBS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)