CAS 878207-28-4 appears in our catalog under these names: Methyl 2-bromo-4,5-difluorobenzoate, 98%, Methyl 2–Bromo–4,5–Difluorobenzoate, Methyl 2-bromo-4,5-difluorobenzoate 98%, Methyl 2-bromo-4,5-difluorobenzoate, 98%, 98%, Methyl 2-Bromo-4,5-difluorobenzoate, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 250mg, 500g.
Methyl 2-bromo-4,5-difluorobenzoate (CAS 878207-28-4) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 2-bromo-4,5-difluorobenzoate. InChIKey: ZCGAVEFBZYWYJW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 2-bromo-4,5-difluorobenzoate |
| InChIKey | ZCGAVEFBZYWYJW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Br)F)F |
Computed by PubChem (NCBI)