Products 88-43-7
CAS 88-43-7 appears in our catalog under these names: 4–Chloroaniline–3–sulfonic Acid, 4-Chloroaniline-3-sulfonic Acid, >98.0%(HPLC)(T), 4-Chloroaniline-3-sulfonic acid, 5-Amino-2-chlorobenzenesulfonic acid 98%, 4-Chloroaniline-3-sulfonic Acid, 98%, 98%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 500g, 50g, 5g, 100g, 1g.
5-amino-2-chlorobenzenesulfonic acid (CAS 88-43-7) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 5-amino-2-chlorobenzenesulfonic acid. InChIKey: VPXCXBHLKDPWQV-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S |
|---|---|
| Molecular weight | 207.64 g/mol |
| IUPAC name | 5-amino-2-chlorobenzenesulfonic acid |
| InChIKey | VPXCXBHLKDPWQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)S(=O)(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
5-Amino-2-chlorobenzenesulfonic Acid, 4-Chloroaniline-3-sulfonic acid, Benzenesulfonic acid, 5-amino-2-chloro-, 4-Chloro-3-sulfoaniline, 3-amino-6-chlorobenzenesulfonic acid, 1-Amino-4-chlorobenzene-3-sulfonic acid, Metanilic acid, 6chloro, pChloroanilinemsulfonic acid, 4Chloroaniline3sulfonic acid, Metanilic acid, 6chloro (8CI)