Products 885519-71-1
CAS 885519-71-1 appears in our catalog under these names: 4-Nitro-1H-indazole-6-carboxylic acid, 97+%, 4-nitro-2H-indazole-6-carboxylic acid, 97%, 4-Nitro-1H-indazole-6-carboxylic acid, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-nitro-1H-indazole-6-carboxylic acid (CAS 885519-71-1) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 4-nitro-1H-indazole-6-carboxylic acid. InChIKey: HIXTUKCZSXGARG-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 4-nitro-1H-indazole-6-carboxylic acid |
| InChIKey | HIXTUKCZSXGARG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NN=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)