CAS 885520-33-2 is the registry number for 3-Bromo-5-methylbenzene-1-sulfonyl chloride, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
3-bromo-5-methylbenzenesulfonyl chloride (CAS 885520-33-2) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 3-bromo-5-methylbenzenesulfonyl chloride. InChIKey: BSYSYHSTNHHVJL-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 3-bromo-5-methylbenzenesulfonyl chloride |
| InChIKey | BSYSYHSTNHHVJL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)