CAS 887586-48-3 appears in our catalog under these names: 2-(4-Bromo-2,3-difluorophenyl)acetic acid, 95%, 2-(4-Bromo-2,3-difluorophenyl)acetic acid, 98%, 2-(4-Bromo-2,3-difluorophenyl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 5g, 0,5g, 50mg.
2-(4-bromo-2,3-difluorophenyl)acetic acid (CAS 887586-48-3) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(4-bromo-2,3-difluorophenyl)acetic acid. InChIKey: OIGMFWLUUCQCFZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(4-bromo-2,3-difluorophenyl)acetic acid |
| InChIKey | OIGMFWLUUCQCFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC(=O)O)F)F)Br |
Computed by PubChem (NCBI)