Products 893729-94-7
CAS 893729-94-7 appears in our catalog under these names: 3-Formyl-4,6-dimethoxy-1H-indole-2-carboxylic acid, 95%, 3-Formyl-4,6-dimethoxy-1H-indole-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 50mg.
3-formyl-4,6-dimethoxy-1H-indole-2-carboxylic acid (CAS 893729-94-7) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 3-formyl-4,6-dimethoxy-1H-indole-2-carboxylic acid. InChIKey: GXOVWZNCYZWVNS-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 3-formyl-4,6-dimethoxy-1H-indole-2-carboxylic acid |
| InChIKey | GXOVWZNCYZWVNS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=C(N2)C(=O)O)C=O |
Computed by PubChem (NCBI)