Products 914637-77-7
CAS 914637-77-7 is the registry number for 5-(2-Furyl)-1,3-oxazole-4-carbonyl chloride, 95.0%. Offered by: Fluorochem. Available pack sizes: 1g.
5-(furan-2-yl)-1,3-oxazole-4-carbonyl chloride (CAS 914637-77-7) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 5-(furan-2-yl)-1,3-oxazole-4-carbonyl chloride. InChIKey: SZCDTFDPOACHRV-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 5-(furan-2-yl)-1,3-oxazole-4-carbonyl chloride |
| InChIKey | SZCDTFDPOACHRV-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=C(N=CO2)C(=O)Cl |
Computed by PubChem (NCBI)