Products 92736-81-7
CAS 92736-81-7 appears in our catalog under these names: 1–(2，4–Dichlorophenyl)–2，2，2–trifluoroethanone, 1-(2,4-Dichlorophenyl)-2,2,2-trifluoroethanone, 2',4'-Dichloro-2,2,2-trifluoroacetophenone, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
1–(2，4–Dichlorophenyl)–2，2，2–trifluoroethanone
GLPBio- size: 100mg, 1g, 250mg
- Variants: 3
from 671.93
1-(2,4-dichlorophenyl)-2,2,2-trifluoroethanone (CAS 92736-81-7) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-2,2,2-trifluoroethanone. InChIKey: MKBRURHQKRNOCM-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | MKBRURHQKRNOCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)