CAS 937691-16-2 is the registry number for 1-Ethyl-2,4-dioxo-7-(propan-2-yl)-1H,2H,3H,4H-pyrido(2,3-d)pyrimidine-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-ethyl-2,4-dioxo-7-propan-2-ylpyrido[2,3-d]pyrimidine-5-carboxylic acid (CAS 937691-16-2) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: 1-ethyl-2,4-dioxo-7-propan-2-ylpyrido[2,3-d]pyrimidine-5-carboxylic acid. InChIKey: MJKPBWIDJWASIC-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 1-ethyl-2,4-dioxo-7-propan-2-ylpyrido[2,3-d]pyrimidine-5-carboxylic acid |
| InChIKey | MJKPBWIDJWASIC-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C(=CC(=N2)C(C)C)C(=O)O)C(=O)NC1=O |
Computed by PubChem (NCBI)