CAS 948-30-1 is the registry number for 4-Methyl-3,5-dinitrobenzonitrile, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
3-methyl-2,6-dinitrobenzonitrile (CAS 948-30-1) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 3-methyl-2,6-dinitrobenzonitrile. InChIKey: GWFIKVZNVDFMQB-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 3-methyl-2,6-dinitrobenzonitrile |
| InChIKey | GWFIKVZNVDFMQB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)