CAS 948-31-2 is the registry number for 2-methyl-3,5-dinitrobenzonitrile. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 5mg, 5000mg.
2-methyl-3,5-dinitrobenzonitrile (CAS 948-31-2) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 2-methyl-3,5-dinitrobenzonitrile. InChIKey: FJPAWDYXHVKZRC-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 2-methyl-3,5-dinitrobenzonitrile |
| InChIKey | FJPAWDYXHVKZRC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)