Products 956508-17-1
CAS 956508-17-1 is the registry number for 1-(4-(Chloromethyl)phenyl)-3,5-dimethyl-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[4-(chloromethyl)phenyl]-3,5-dimethylpyrazole (CAS 956508-17-1) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 1-[4-(chloromethyl)phenyl]-3,5-dimethylpyrazole. InChIKey: UGYPAKPLVBBMRT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 1-[4-(chloromethyl)phenyl]-3,5-dimethylpyrazole |
| InChIKey | UGYPAKPLVBBMRT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)CCl)C |
Computed by PubChem (NCBI)