CAS 99069-59-7 appears in our catalog under these names: Adrenochrome Impurity 4, 3-Deshydroxy-Carbazochrome. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(6-hydroxy-1-methyl-2,3-dihydroindol-5-yl)iminourea (CAS 99069-59-7) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: (6-hydroxy-1-methyl-2,3-dihydroindol-5-yl)iminourea. InChIKey: NUSIFTHCDGYOSP-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | (6-hydroxy-1-methyl-2,3-dihydroindol-5-yl)iminourea |
| InChIKey | NUSIFTHCDGYOSP-UHFFFAOYSA-N |
| SMILES | CN1CCC2=CC(=C(C=C21)O)N=NC(=O)N |
Computed by PubChem (NCBI)