cas: 24974-74-1 — see every product listed under this CAS number, including other names
(2-Bromophenyl)methanesulfonyl chloride, 95% (CAS 24974-74-1) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A847773-25g |
| cas | 24974-74-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 6671.14 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-bromophenyl)methanesulfonyl chloride (CAS 24974-74-1) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: (2-bromophenyl)methanesulfonyl chloride. InChIKey: RDRCWHIGMBAULL-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | (2-bromophenyl)methanesulfonyl chloride |
| InChIKey | RDRCWHIGMBAULL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)