cas: 24974-74-1 — see every product listed under this CAS number, including other names
2-Bromobenzylsulfonyl chloride, 95% (CAS 24974-74-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g, 1g, 250mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | JG-3476-25g |
| cas | 24974-74-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 622.72 Pln | |
| Fluorochem | 1g | 1143.37 Pln | |
| Fluorochem | 5g | 4027.77 Pln | |
| Fluorochem | 10g | 6651.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(2-bromophenyl)methanesulfonyl chloride (CAS 24974-74-1) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: (2-bromophenyl)methanesulfonyl chloride. InChIKey: RDRCWHIGMBAULL-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | (2-bromophenyl)methanesulfonyl chloride |
| InChIKey | RDRCWHIGMBAULL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)