cas: 1498333-87-1 — see every product listed under this CAS number, including other names
(4-(Pyridin-2-yl)phenyl)methanamine hydrochloride, 95%, 95% (CAS 1498333-87-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXQS-100mg |
| cas | 1498333-87-1 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 630.80 Pln | |
| Chemat | 10g | 1197.20 Pln | |
| Chemat | 25g | 2896.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4-pyridin-2-ylphenyl)methanamine;hydrochloride (CAS 1498333-87-1) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: (4-pyridin-2-ylphenyl)methanamine;hydrochloride. InChIKey: CIJJNYGBSSBMHU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | (4-pyridin-2-ylphenyl)methanamine;hydrochloride |
| InChIKey | CIJJNYGBSSBMHU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)