cas: 1498333-87-1 — see every product listed under this CAS number, including other names
(4-(Pyridin-2-yl)phenyl)methanamine hydrochloride, 95% (CAS 1498333-87-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 250mg, 10g, 1g, 100mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QD-7131-5g |
| cas | 1498333-87-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 820.56 Pln | |
| Fluorochem | 10g | 1575.50 Pln | |
| Fluorochem | 25g | 3855.95 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(4-pyridin-2-ylphenyl)methanamine;hydrochloride (CAS 1498333-87-1) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: (4-pyridin-2-ylphenyl)methanamine;hydrochloride. InChIKey: CIJJNYGBSSBMHU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | (4-pyridin-2-ylphenyl)methanamine;hydrochloride |
| InChIKey | CIJJNYGBSSBMHU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)