cas: 212386-71-5 — see every product listed under this CAS number, including other names
(4-Ethoxy-2,3-difluorophenyl)boronic acid 97% (CAS 212386-71-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A168155-5g |
| cas | 212386-71-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 882.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A168155 |
(4-ethoxy-2,3-difluorophenyl)boronic acid (CAS 212386-71-5) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (4-ethoxy-2,3-difluorophenyl)boronic acid. InChIKey: OBKSFBWOZSQGGC-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (4-ethoxy-2,3-difluorophenyl)boronic acid |
| InChIKey | OBKSFBWOZSQGGC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC)F)F)(O)O |
Computed by PubChem (NCBI)