(4-Ethoxy-2,3-difluorophenyl)boronic acid, 97%, 97%
cas: 212386-71-5 — see every product listed under this CAS number, including other names
(4-Ethoxy-2,3-difluorophenyl)boronic acid, 97%, 97% (CAS 212386-71-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BDSX-250mg |
| cas | 212386-71-5 |
| size | 250mg |
| availability | 400g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 261.20 Pln | |
| Chemat | 100g | 741.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-ethoxy-2,3-difluorophenyl)boronic acid (CAS 212386-71-5) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (4-ethoxy-2,3-difluorophenyl)boronic acid. InChIKey: OBKSFBWOZSQGGC-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (4-ethoxy-2,3-difluorophenyl)boronic acid |
| InChIKey | OBKSFBWOZSQGGC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC)F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
B-(4-Ethoxy-2,3-difluorophenyl)boronic acid, (4-Ethoxy-2,3-difluorophenyl)boronic acid, 2,3-Difluoro-4-Ethoxybenzeneboronic Acid, 4-ethoxy-2,3-difluorophenylboronic acid, (4-Ethoxy-2,3-difluoro-phenyl)boronic acid, (4-Ethoxy-2,3-difluorophenyl)boronicacid, Boronic acid, (4-ethoxy-2,3-difluorophenyl)-, 4-Ethoxy-2,3-difluorobenzeneboronic Acid, 2,3-Difluoro-4-ethoxyphenylboronic acid(contains varying amounts of Anhydride), 4-Ethoxy-2,3-difluorophenylboronic Acid (contains varying amounts of Anhydride)