cas: 212386-71-5 — see every product listed under this CAS number, including other names
2,3-Difluoro-4-ethoxyphenylboronic acid, 95% (CAS 212386-71-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223770-1G |
| cas | 212386-71-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 320.74 Pln | |
| Fluorochem | 100g | 1002.79 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(4-ethoxy-2,3-difluorophenyl)boronic acid (CAS 212386-71-5) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (4-ethoxy-2,3-difluorophenyl)boronic acid. InChIKey: OBKSFBWOZSQGGC-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (4-ethoxy-2,3-difluorophenyl)boronic acid |
| InChIKey | OBKSFBWOZSQGGC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC)F)F)(O)O |
Computed by PubChem (NCBI)