cas: 2468045-30-7 — see every product listed under this CAS number, including other names
(4-Formyl-2,5-dimethoxyphenyl)boronic acid 98% (CAS 2468045-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1632663-100mg |
| cas | 2468045-30-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 1010.06 Pln | |
| Ambeed | 5g | 3518.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1632663 |
(4-formyl-2,5-dimethoxyphenyl)boronic acid (CAS 2468045-30-7) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-formyl-2,5-dimethoxyphenyl)boronic acid. InChIKey: DTUOLKLERIMYCW-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-formyl-2,5-dimethoxyphenyl)boronic acid |
| InChIKey | DTUOLKLERIMYCW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)