cas: 490034-80-5 — see every product listed under this CAS number, including other names
(S)-3-Amino-3-(3-fluorophenyl)propanoic acid hydrochloride, 97% (CAS 490034-80-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A819733-10g |
| cas | 490034-80-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6931.54 Pln | |
| AmBeed | 5g | 4640.02 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S)-3-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride (CAS 490034-80-5) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: (3S)-3-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride. InChIKey: OLDBXSVVQBASPG-QRPNPIFTSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride |
| InChIKey | OLDBXSVVQBASPG-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)