CAS 2657665-78-4 is the registry number for (6-Fluoro-2,3-dihydrobenzo[b][1,4]dioxin-5-yl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)methanamine;hydrochloride (CAS 2657665-78-4) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: (6-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)methanamine;hydrochloride. InChIKey: PWZQTICIFGBMLL-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | (6-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl)methanamine;hydrochloride |
| InChIKey | PWZQTICIFGBMLL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2CN)F.Cl |
Computed by PubChem (NCBI)