cas: 13590-42-6 — see every product listed under this CAS number, including other names
(S)-Benzyl 2-(2,5-dioxooxazolidin-4-yl)acetate, 95% (CAS 13590-42-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F053865-5G |
| cas | 13590-42-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 10g | 331.15 Pln | |
| Fluorochem | 25g | 726.85 Pln | |
| Fluorochem | 100g | 2257.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Benzyl 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetate (CAS 13590-42-6) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: benzyl 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetate. InChIKey: QNIPTEJAZIWFHH-VIFPVBQESA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | benzyl 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetate |
| InChIKey | QNIPTEJAZIWFHH-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C[C@H]2C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)