cas: 13590-42-6 — see every product listed under this CAS number, including other names
L-Aspartic acid β-benzyl ester N-carboxylic acid anhydride, 95%, 95% (CAS 13590-42-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LY2-1g |
| cas | 13590-42-6 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 218.00 Pln | |
| Chemat | 25g | 453.20 Pln | |
| Chemat | 100g | 1528.40 Pln | |
| Chemat | 500g | 5990.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetate (CAS 13590-42-6) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: benzyl 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetate. InChIKey: QNIPTEJAZIWFHH-VIFPVBQESA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | benzyl 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetate |
| InChIKey | QNIPTEJAZIWFHH-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C[C@H]2C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)