cas: 530-47-2 — see every product listed under this CAS number, including other names
1,1-Diphenylhydrazine hydrochloride 95% (CAS 530-47-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A864578-5g |
| cas | 530-47-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 921.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A864578 |
1,1-diphenylhydrazine;hydrochloride (CAS 530-47-2) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 1,1-diphenylhydrazine;hydrochloride. InChIKey: MIVUDWFNUOXEJM-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 1,1-diphenylhydrazine;hydrochloride |
| InChIKey | MIVUDWFNUOXEJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)