cas: 15298-58-5 — see every product listed under this CAS number, including other names
1,4-Dichloroisoquinoline, 95%, 95% (CAS 15298-58-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118YFH-250mg |
| cas | 15298-58-5 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 611.60 Pln | |
| Chemat | 25g | 1437.20 Pln | |
| Chemat | 100mg | 83.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,4-dichloroisoquinoline (CAS 15298-58-5) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,4-dichloroisoquinoline. InChIKey: HAOKHVBZPIURMZ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,4-dichloroisoquinoline |
| InChIKey | HAOKHVBZPIURMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Cl)Cl |
Computed by PubChem (NCBI)