cas: 4752-10-7 — see every product listed under this CAS number, including other names
1,4-Dichlorophthalazine, 95%, 95% (CAS 4752-10-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 1kg, 5kg, 10kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143MW-1g |
| cas | 4752-10-7 |
| size | 1g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 414.80 Pln | |
| Chemat | 1kg | 1355.60 Pln | |
| Chemat | 5kg | 6369.60 Pln | |
| Chemat | 10kg | price on request |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,4-dichlorophthalazine (CAS 4752-10-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 1,4-dichlorophthalazine. InChIKey: ODCNAEMHGMYADO-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 1,4-dichlorophthalazine |
| InChIKey | ODCNAEMHGMYADO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)