1,6-Dichloroisoquinoline, 95%
cas: 630421-73-7 — see every product listed under this CAS number, including other names
1,6-Dichloroisoquinoline, 95% (CAS 630421-73-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093667-250MG |
| cas | 630421-73-7 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 456.11 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,6-dichloroisoquinoline (CAS 630421-73-7) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,6-dichloroisoquinoline. InChIKey: JTCCQIDTKFGEQY-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,6-dichloroisoquinoline |
| InChIKey | JTCCQIDTKFGEQY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2Cl)C=C1Cl |
Computed by PubChem (NCBI)