1,6-Dichloroisoquinoline, 98%, 98%
cas: 630421-73-7 — see every product listed under this CAS number, including other names
1,6-Dichloroisoquinoline, 98%, 98% (CAS 630421-73-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11485R-100mg |
| cas | 630421-73-7 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 237.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,6-dichloroisoquinoline (CAS 630421-73-7) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,6-dichloroisoquinoline. InChIKey: JTCCQIDTKFGEQY-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,6-dichloroisoquinoline |
| InChIKey | JTCCQIDTKFGEQY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2Cl)C=C1Cl |
Computed by PubChem (NCBI)