cas: 607-68-1 — see every product listed under this CAS number, including other names
2,4-Dichloroquinazoline 97% (CAS 607-68-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A144334-10g |
| cas | 607-68-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 181.25 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 876.56 Pln | |
| Ambeed | 500g | 3296.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A144334 |
2,4-dichloroquinazoline (CAS 607-68-1) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,4-dichloroquinazoline. InChIKey: TUQSVSYUEBNNKQ-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,4-dichloroquinazoline |
| InChIKey | TUQSVSYUEBNNKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)