Products 1299607-61-6
CAS 1299607-61-6 is the registry number for 2,5-Dichloro-3-(dimethoxymethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,5-dichloro-3-(dimethoxymethyl)pyridine (CAS 1299607-61-6) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: 2,5-dichloro-3-(dimethoxymethyl)pyridine. InChIKey: JWEKIYARKOGXPR-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2,5-dichloro-3-(dimethoxymethyl)pyridine |
| InChIKey | JWEKIYARKOGXPR-UHFFFAOYSA-N |
| SMILES | COC(C1=C(N=CC(=C1)Cl)Cl)OC |
Computed by PubChem (NCBI)