cas: 1780785-72-9 — see every product listed under this CAS number, including other names
2-(2-Bromo-3,4-difluorophenyl)acetic acid 97% (CAS 1780785-72-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A318741-250mg |
| cas | 1780785-72-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 665.19 Pln | |
| Ambeed | 5g | 2745.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A318741 |
2-(2-bromo-3,4-difluorophenyl)acetic acid (CAS 1780785-72-9) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(2-bromo-3,4-difluorophenyl)acetic acid. InChIKey: NYGFDSVWTYZHQM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(2-bromo-3,4-difluorophenyl)acetic acid |
| InChIKey | NYGFDSVWTYZHQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC(=O)O)Br)F)F |
Computed by PubChem (NCBI)